About N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate
N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate (PubChem CID 77134591) has the molecular formula C12H10NO5-
and a molecular weight of 248.21 g/mol. Its IUPAC name is N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate.
Molecular Properties
| Compound Name | N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate |
| PubChem CID | 77134591 |
| Molecular Formula | C12H10NO5- |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate |
| SMILES | O=C1C[C@@H](N(Cc2ccccc2)C(=O)[O-])C(=O)O1 |
| InChI | InChI=1S/C12H11NO5/c14-10-6-9(11(15)18-10)13(12(16)17)7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,16,17)/p-1/t9-/m1/s1 |
| InChIKey | GFZUXIWFHLHMTE-SECBINFHSA-M |
| XLogP | -0.33 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate?
The IUPAC name of N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate (CID 77134591) is N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate.
What is the SMILES notation for N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate?
The canonical SMILES for N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate is O=C1C[C@@H](N(Cc2ccccc2)C(=O)[O-])C(=O)O1.
What is the InChIKey of N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate?
The InChIKey is GFZUXIWFHLHMTE-SECBINFHSA-M. The full InChI is InChI=1S/C12H11NO5/c14-10-6-9(11(15)18-10)13(12(16)17)7-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,16,17)/p-1/t9-/m1/s1.
What are the key properties of N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate?
N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate has a molecular weight of 248.21 g/mol, XLogP of -0.33, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[(3R)-2,5-dioxooxolan-3-yl]carbamate is sourced from PubChem (CID 77134591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).