C21H20N3O5- — CID 57353267
N-[(3S)-1-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-2,5-dioxopyrrolidin-3-yl]-N-benzylcarbamate (PubChem CID 57353267) has the molecular formula C21H20N3O5- and a molecular weight of 394.41 g/mol. Its IUPAC name is N-[(3S)-1-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-2,5-dioxopyrrolidin-3-yl]-N-benzylcarbamate.
| Compound Name | N-[(3S)-1-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-2,5-dioxopyrrolidin-3-yl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 57353267 |
| Molecular Formula | C21H20N3O5- |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[(3S)-1-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-2,5-dioxopyrrolidin-3-yl]-N-benzylcarbamate |
| SMILES | NC(=O)[C@H](Cc1ccccc1)N1C(=O)C[C@H](N(Cc2ccccc2)C(=O)[O-])C1=O |
| InChI | InChI=1S/C21H21N3O5/c22-19(26)16(11-14-7-3-1-4-8-14)24-18(25)12-17(20(24)27)23(21(28)29)13-15-9-5-2-6-10-15/h1-10,16-17H,11-13H2,(H2,22,26)(H,28,29)/p-1/t16-,17-/m0/s1 |
| InChIKey | LQYSKQHVUTVXGA-IRXDYDNUSA-M |
| XLogP | 0.06 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|