C12H23N3O4S2 — CID 77135708
2-(3-ethylsulfonylthiomorpholine-4-carbonyl)-N'-hydroxypentanimidamide (PubChem CID 77135708) has the molecular formula C12H23N3O4S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-(3-ethylsulfonylthiomorpholine-4-carbonyl)-N'-hydroxypentanimidamide.
| Compound Name | 2-(3-ethylsulfonylthiomorpholine-4-carbonyl)-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 77135708 |
| Molecular Formula | C12H23N3O4S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-(3-ethylsulfonylthiomorpholine-4-carbonyl)-N'-hydroxypentanimidamide |
| SMILES | CCCC(C(=O)N1CCSCC1S(=O)(=O)CC)C(N)=NO |
| InChI | InChI=1S/C12H23N3O4S2/c1-3-5-9(11(13)14-17)12(16)15-6-7-20-8-10(15)21(18,19)4-2/h9-10,17H,3-8H2,1-2H3,(H2,13,14) |
| InChIKey | RHXBBGVJEYOIMI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|