C13H19N3O2S2 — CID 66375827
3-ethylsulfonyl-N'-phenylthiomorpholine-4-carboximidamide (PubChem CID 66375827) has the molecular formula C13H19N3O2S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 3-ethylsulfonyl-N'-phenylthiomorpholine-4-carboximidamide.
| Compound Name | 3-ethylsulfonyl-N'-phenylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 66375827 |
| Molecular Formula | C13H19N3O2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-ethylsulfonyl-N'-phenylthiomorpholine-4-carboximidamide |
| SMILES | CCS(=O)(=O)C1CSCCN1/C(N)=N/c1ccccc1 |
| InChI | InChI=1S/C13H19N3O2S2/c1-2-20(17,18)12-10-19-9-8-16(12)13(14)15-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3,(H2,14,15) |
| InChIKey | BZQUMCLZJBANTE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|