C24H38N2O5S2 — CID 77197691
butyl 2-[2-[4-(4-hydroxy-4-methylnon-1-enyl)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate (PubChem CID 77197691) has the molecular formula C24H38N2O5S2 and a molecular weight of 498.71 g/mol. Its IUPAC name is butyl 2-[2-[4-(4-hydroxy-4-methylnon-1-enyl)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate.
| Compound Name | butyl 2-[2-[4-(4-hydroxy-4-methylnon-1-enyl)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 77197691 |
| Molecular Formula | C24H38N2O5S2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | butyl 2-[2-[4-(4-hydroxy-4-methylnon-1-enyl)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCCCCC(C)(O)CC=CC1C(C)OC(=O)N1CCSc1nc(C(=O)OCCCC)cs1 |
| InChI | InChI=1S/C24H38N2O5S2/c1-5-7-9-12-24(4,29)13-10-11-20-18(3)31-23(28)26(20)14-16-32-22-25-19(17-33-22)21(27)30-15-8-6-2/h10-11,17-18,20,29H,5-9,12-16H2,1-4H3 |
| InChIKey | XZOYFYHTMXNHJX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|