C19H37N3 — CID 77234085
N-(3,7-dimethylocta-2,6-dienyl)-N'-(2-ethylpiperidin-1-yl)ethane-1,2-diamine (PubChem CID 77234085) has the molecular formula C19H37N3 and a molecular weight of 307.53 g/mol. Its IUPAC name is N-(3,7-dimethylocta-2,6-dienyl)-N'-(2-ethylpiperidin-1-yl)ethane-1,2-diamine.
| Compound Name | N-(3,7-dimethylocta-2,6-dienyl)-N'-(2-ethylpiperidin-1-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 77234085 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | N-(3,7-dimethylocta-2,6-dienyl)-N'-(2-ethylpiperidin-1-yl)ethane-1,2-diamine |
| SMILES | CCC1CCCCN1NCCNCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C19H37N3/c1-5-19-11-6-7-16-22(19)21-15-14-20-13-12-18(4)10-8-9-17(2)3/h9,12,19-21H,5-8,10-11,13-16H2,1-4H3 |
| InChIKey | UJNKRPCECIJAQZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|