About 2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate
2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate (PubChem CID 7724426) has the molecular formula C17H18O5S
and a molecular weight of 334.39 g/mol. Its IUPAC name is 2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate.
Molecular Properties
| Compound Name | 2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate |
| PubChem CID | 7724426 |
| Molecular Formula | C17H18O5S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate |
| SMILES | Cc1ccccc1OCCOC(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C17H18O5S/c1-13-7-3-5-9-15(13)21-11-12-22-17(18)14-8-4-6-10-16(14)23(2,19)20/h3-10H,11-12H2,1-2H3 |
| InChIKey | CWPCUKCZOWJCGL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate?
The IUPAC name of 2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate (CID 7724426) is 2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate.
What is the SMILES notation for 2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate?
The canonical SMILES for 2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate is Cc1ccccc1OCCOC(=O)c1ccccc1S(C)(=O)=O.
What is the InChIKey of 2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate?
The InChIKey is CWPCUKCZOWJCGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O5S/c1-13-7-3-5-9-15(13)21-11-12-22-17(18)14-8-4-6-10-16(14)23(2,19)20/h3-10H,11-12H2,1-2H3.
What are the key properties of 2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate?
2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate has a molecular weight of 334.39 g/mol, XLogP of 2.63, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylphenoxy)ethyl 2-methylsulfonylbenzoate is sourced from PubChem (CID 7724426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).