C28H28O8 — CID 118286038
4-O-[2-(2-methylbenzoyl)oxyethyl] 1-O-[2-[(2-methylphenoxy)methoxy]ethyl] benzene-1,4-dicarboxylate (PubChem CID 118286038) has the molecular formula C28H28O8 and a molecular weight of 492.52 g/mol. Its IUPAC name is 4-O-[2-(2-methylbenzoyl)oxyethyl] 1-O-[2-[(2-methylphenoxy)methoxy]ethyl] benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[2-(2-methylbenzoyl)oxyethyl] 1-O-[2-[(2-methylphenoxy)methoxy]ethyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 118286038 |
| Molecular Formula | C28H28O8 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 4-O-[2-(2-methylbenzoyl)oxyethyl] 1-O-[2-[(2-methylphenoxy)methoxy]ethyl] benzene-1,4-dicarboxylate |
| SMILES | Cc1ccccc1OCOCCOC(=O)c1ccc(C(=O)OCCOC(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C28H28O8/c1-20-7-3-5-9-24(20)28(31)35-18-17-34-27(30)23-13-11-22(12-14-23)26(29)33-16-15-32-19-36-25-10-6-4-8-21(25)2/h3-14H,15-19H2,1-2H3 |
| InChIKey | WEBVJSLQLQNIGM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|