C36H46N2O7 — CID 77253546
4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-hydroxyethyl]phenol;4-[2-[4-(4-hydroxyphenyl)butan-2-ylamino]ethyl]benzene-1,2-diol (PubChem CID 77253546) has the molecular formula C36H46N2O7 and a molecular weight of 618.77 g/mol. Its IUPAC name is 4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-hydroxyethyl]phenol;4-[2-[4-(4-hydroxyphenyl)butan-2-ylamino]ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-hydroxyethyl]phenol;4-[2-[4-(4-hydroxyphenyl)butan-2-ylamino]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 77253546 |
| Molecular Formula | C36H46N2O7 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | 4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-hydroxyethyl]phenol;4-[2-[4-(4-hydroxyphenyl)butan-2-ylamino]ethyl]benzene-1,2-diol |
| SMILES | CC(CCc1ccc(O)cc1)NCCc1ccc(O)c(O)c1.COc1ccc(CCNCC(O)c2ccc(O)cc2)cc1OC |
| InChI | InChI=1S/C18H23NO4.C18H23NO3/c1-22-17-8-3-13(11-18(17)23-2)9-10-19-12-16(21)14-4-6-15(20)7-5-14;1-13(2-3-14-4-7-16(20)8-5-14)19-11-10-15-6-9-17(21)18(22)12-15/h3-8,11,16,19-21H,9-10,12H2,1-2H3;4-9,12-13,19-22H,2-3,10-11H2,1H3 |
| InChIKey | GYTVWXNLTOLPRA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 143.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|