C21H26BrNO3S — CID 77259945
N-[4-[2-(5-bromo-3-tert-butyl-2-methoxyphenyl)ethenyl]phenyl]ethanesulfonamide (PubChem CID 77259945) has the molecular formula C21H26BrNO3S and a molecular weight of 452.41 g/mol. Its IUPAC name is N-[4-[2-(5-bromo-3-tert-butyl-2-methoxyphenyl)ethenyl]phenyl]ethanesulfonamide.
| Compound Name | N-[4-[2-(5-bromo-3-tert-butyl-2-methoxyphenyl)ethenyl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 77259945 |
| Molecular Formula | C21H26BrNO3S |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | N-[4-[2-(5-bromo-3-tert-butyl-2-methoxyphenyl)ethenyl]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(C=Cc2cc(Br)cc(C(C)(C)C)c2OC)cc1 |
| InChI | InChI=1S/C21H26BrNO3S/c1-6-27(24,25)23-18-11-8-15(9-12-18)7-10-16-13-17(22)14-19(20(16)26-5)21(2,3)4/h7-14,23H,6H2,1-5H3 |
| InChIKey | SLYOYUWJOISWOU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|