C20H24BrNO — CID 88996688
4-[(E)-2-(5-bromo-3-tert-butyl-2-methoxyphenyl)ethenyl]-3-methylaniline (PubChem CID 88996688) has the molecular formula C20H24BrNO and a molecular weight of 374.32 g/mol. Its IUPAC name is 4-[(E)-2-(5-bromo-3-tert-butyl-2-methoxyphenyl)ethenyl]-3-methylaniline.
| Compound Name | 4-[(E)-2-(5-bromo-3-tert-butyl-2-methoxyphenyl)ethenyl]-3-methylaniline |
|---|---|
| PubChem CID | 88996688 |
| Molecular Formula | C20H24BrNO |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 4-[(E)-2-(5-bromo-3-tert-butyl-2-methoxyphenyl)ethenyl]-3-methylaniline |
| SMILES | COc1c(/C=C/c2ccc(N)cc2C)cc(Br)cc1C(C)(C)C |
| InChI | InChI=1S/C20H24BrNO/c1-13-10-17(22)9-8-14(13)6-7-15-11-16(21)12-18(19(15)23-5)20(2,3)4/h6-12H,22H2,1-5H3/b7-6+ |
| InChIKey | LSNKITRKKLNNCE-VOTSOKGWSA-N |
| XLogP | 5.82 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|