C21H17N3O4 — CID 7726248
[2-[N-(cyanomethyl)anilino]-2-oxoethyl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 7726248) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 7726248 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | Cc1oc(-c2ccccc2)nc1C(=O)OCC(=O)N(CC#N)c1ccccc1 |
| InChI | InChI=1S/C21H17N3O4/c1-15-19(23-20(28-15)16-8-4-2-5-9-16)21(26)27-14-18(25)24(13-12-22)17-10-6-3-7-11-17/h2-11H,13-14H2,1H3 |
| InChIKey | ICKSBKLZOFQWAY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 96.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|