C22H14NO3S2- — CID 7730002
4-methyl-3-[(5Z)-5-(naphthalen-1-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate (PubChem CID 7730002) has the molecular formula C22H14NO3S2- and a molecular weight of 404.49 g/mol. Its IUPAC name is 4-methyl-3-[(5Z)-5-(naphthalen-1-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | 4-methyl-3-[(5Z)-5-(naphthalen-1-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 7730002 |
| Molecular Formula | C22H14NO3S2- |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 4-methyl-3-[(5Z)-5-(naphthalen-1-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1N1C(=O)/C(=C/c2cccc3ccccc23)SC1=S |
| InChI | InChI=1S/C22H15NO3S2/c1-13-9-10-16(21(25)26)11-18(13)23-20(24)19(28-22(23)27)12-15-7-4-6-14-5-2-3-8-17(14)15/h2-12H,1H3,(H,25,26)/p-1/b19-12- |
| InChIKey | OJYPMPRRALYNLG-UNOMPAQXSA-M |
| XLogP | 3.92 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|