About dibenzofuran-3-yl 4-bromobenzenesulfonate
dibenzofuran-3-yl 4-bromobenzenesulfonate (PubChem CID 7731222) has the molecular formula C18H11BrO4S
and a molecular weight of 403.25 g/mol. Its IUPAC name is dibenzofuran-3-yl 4-bromobenzenesulfonate.
Molecular Properties
| Compound Name | dibenzofuran-3-yl 4-bromobenzenesulfonate |
| PubChem CID | 7731222 |
| Molecular Formula | C18H11BrO4S |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | dibenzofuran-3-yl 4-bromobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)oc1ccccc12)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H11BrO4S/c19-12-5-8-14(9-6-12)24(20,21)23-13-7-10-16-15-3-1-2-4-17(15)22-18(16)11-13/h1-11H |
| InChIKey | RTTFXQPSABDBMO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze dibenzofuran-3-yl 4-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran-3-yl 4-bromobenzenesulfonate?
The IUPAC name of dibenzofuran-3-yl 4-bromobenzenesulfonate (CID 7731222) is dibenzofuran-3-yl 4-bromobenzenesulfonate.
What is the SMILES notation for dibenzofuran-3-yl 4-bromobenzenesulfonate?
The canonical SMILES for dibenzofuran-3-yl 4-bromobenzenesulfonate is O=S(=O)(Oc1ccc2c(c1)oc1ccccc12)c1ccc(Br)cc1.
What is the InChIKey of dibenzofuran-3-yl 4-bromobenzenesulfonate?
The InChIKey is RTTFXQPSABDBMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11BrO4S/c19-12-5-8-14(9-6-12)24(20,21)23-13-7-10-16-15-3-1-2-4-17(15)22-18(16)11-13/h1-11H.
What are the key properties of dibenzofuran-3-yl 4-bromobenzenesulfonate?
dibenzofuran-3-yl 4-bromobenzenesulfonate has a molecular weight of 403.25 g/mol, XLogP of 5.12, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran-3-yl 4-bromobenzenesulfonate is sourced from PubChem (CID 7731222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).