C19H15NO7 — CID 7734308
methyl 5-[[4-(furan-2-carbonylamino)benzoyl]oxymethyl]furan-2-carboxylate (PubChem CID 7734308) has the molecular formula C19H15NO7 and a molecular weight of 369.33 g/mol. Its IUPAC name is methyl 5-[[4-(furan-2-carbonylamino)benzoyl]oxymethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-(furan-2-carbonylamino)benzoyl]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 7734308 |
| Molecular Formula | C19H15NO7 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | methyl 5-[[4-(furan-2-carbonylamino)benzoyl]oxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)c2ccc(NC(=O)c3ccco3)cc2)o1 |
| InChI | InChI=1S/C19H15NO7/c1-24-19(23)16-9-8-14(27-16)11-26-18(22)12-4-6-13(7-5-12)20-17(21)15-3-2-10-25-15/h2-10H,11H2,1H3,(H,20,21) |
| InChIKey | QIDKNWXGZLMVSF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |