C17H16N2O3S2 — CID 7735582
2-(3-methylphenoxy)ethyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate (PubChem CID 7735582) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate.
| Compound Name | 2-(3-methylphenoxy)ethyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate |
|---|---|
| PubChem CID | 7735582 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate |
| SMILES | Cc1cccc(OCCOC(=O)CSc2ncnc3sccc23)c1 |
| InChI | InChI=1S/C17H16N2O3S2/c1-12-3-2-4-13(9-12)21-6-7-22-15(20)10-24-17-14-5-8-23-16(14)18-11-19-17/h2-5,8-9,11H,6-7,10H2,1H3 |
| InChIKey | LLQQDNUYJVXXRU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|