C15H11N3O4S2 — CID 7736073
(4-nitrophenyl)methyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate (PubChem CID 7736073) has the molecular formula C15H11N3O4S2 and a molecular weight of 361.40 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate.
| Compound Name | (4-nitrophenyl)methyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate |
|---|---|
| PubChem CID | 7736073 |
| Molecular Formula | C15H11N3O4S2 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | (4-nitrophenyl)methyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate |
| SMILES | O=C(CSc1ncnc2sccc12)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11N3O4S2/c19-13(22-7-10-1-3-11(4-2-10)18(20)21)8-24-15-12-5-6-23-14(12)16-9-17-15/h1-6,9H,7-8H2 |
| InChIKey | HSWXOZWQGNWGSU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 95.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|