C10H10N2O3S2 — CID 24518916
2-hydroxyethyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate (PubChem CID 24518916) has the molecular formula C10H10N2O3S2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-hydroxyethyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate.
| Compound Name | 2-hydroxyethyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate |
|---|---|
| PubChem CID | 24518916 |
| Molecular Formula | C10H10N2O3S2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 2-hydroxyethyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate |
| SMILES | O=C(CSc1ncnc2sccc12)OCCO |
| InChI | InChI=1S/C10H10N2O3S2/c13-2-3-15-8(14)5-17-10-7-1-4-16-9(7)11-6-12-10/h1,4,6,13H,2-3,5H2 |
| InChIKey | OGTASRRJMZHFFR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |