C18H17N3O4S2 — CID 8565787
[2-oxo-2-(2-phenoxyethylamino)ethyl] 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate (PubChem CID 8565787) has the molecular formula C18H17N3O4S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is [2-oxo-2-(2-phenoxyethylamino)ethyl] 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate.
| Compound Name | [2-oxo-2-(2-phenoxyethylamino)ethyl] 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate |
|---|---|
| PubChem CID | 8565787 |
| Molecular Formula | C18H17N3O4S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | [2-oxo-2-(2-phenoxyethylamino)ethyl] 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ncnc2sccc12)NCCOc1ccccc1 |
| InChI | InChI=1S/C18H17N3O4S2/c22-15(19-7-8-24-13-4-2-1-3-5-13)10-25-16(23)11-27-18-14-6-9-26-17(14)20-12-21-18/h1-6,9,12H,7-8,10-11H2,(H,19,22) |
| InChIKey | LCSLLUBCHLOSFU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|