C16H14N2O3S3 — CID 7735604
(4-oxo-4-thiophen-2-ylbutyl) 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate (PubChem CID 7735604) has the molecular formula C16H14N2O3S3 and a molecular weight of 378.50 g/mol. Its IUPAC name is (4-oxo-4-thiophen-2-ylbutyl) 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate.
| Compound Name | (4-oxo-4-thiophen-2-ylbutyl) 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate |
|---|---|
| PubChem CID | 7735604 |
| Molecular Formula | C16H14N2O3S3 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | (4-oxo-4-thiophen-2-ylbutyl) 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate |
| SMILES | O=C(CSc1ncnc2sccc12)OCCCC(=O)c1cccs1 |
| InChI | InChI=1S/C16H14N2O3S3/c19-12(13-4-2-7-22-13)3-1-6-21-14(20)9-24-16-11-5-8-23-15(11)17-10-18-16/h2,4-5,7-8,10H,1,3,6,9H2 |
| InChIKey | SHJOBMMLOODBTG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|