C16H12N2O3S2 — CID 7742490
phenacyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate (PubChem CID 7742490) has the molecular formula C16H12N2O3S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is phenacyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate.
| Compound Name | phenacyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate |
|---|---|
| PubChem CID | 7742490 |
| Molecular Formula | C16H12N2O3S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | phenacyl 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetate |
| SMILES | O=C(CSc1ncnc2sccc12)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H12N2O3S2/c19-13(11-4-2-1-3-5-11)8-21-14(20)9-23-16-12-6-7-22-15(12)17-10-18-16/h1-7,10H,8-9H2 |
| InChIKey | KWKQUEDZVCQNTK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |