C36H48F4N6O8S2 — CID 77379198
2,7-diamino-1,8-bis[6-[(3,4-difluorophenoxy)methyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]octane-1,8-dione (PubChem CID 77379198) has the molecular formula C36H48F4N6O8S2 and a molecular weight of 832.94 g/mol. Its IUPAC name is 2,7-diamino-1,8-bis[6-[(3,4-difluorophenoxy)methyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]octane-1,8-dione.
| Compound Name | 2,7-diamino-1,8-bis[6-[(3,4-difluorophenoxy)methyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]octane-1,8-dione |
|---|---|
| PubChem CID | 77379198 |
| Molecular Formula | C36H48F4N6O8S2 |
| Molecular Weight | 832.94 g/mol |
| Exact Mass | 832.29 |
| IUPAC Name | 2,7-diamino-1,8-bis[6-[(3,4-difluorophenoxy)methyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]octane-1,8-dione |
| SMILES | CS(=O)(=O)N1CC(COc2ccc(F)c(F)c2)C2C1CCN2C(=O)C(N)CCCCC(N)C(=O)N1CCC2C1C(COc1ccc(F)c(F)c1)CN2S(C)(=O)=O |
| InChI | InChI=1S/C36H48F4N6O8S2/c1-55(49,50)45-17-21(19-53-23-7-9-25(37)27(39)15-23)33-31(45)11-13-43(33)35(47)29(41)5-3-4-6-30(42)36(48)44-14-12-32-34(44)22(18-46(32)56(2,51)52)20-54-24-8-10-26(38)28(40)16-24/h7-10,15-16,21-22,29-34H,3-6,11-14,17-20,41-42H2,1-2H3 |
| InChIKey | HDLQIRSJNMUXJR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 185.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.94 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|