C36H50F2N6O8S2 — CID 77379193
2,7-diamino-1,8-bis[6-[(4-fluorophenyl)methoxy]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]octane-1,8-dione (PubChem CID 77379193) has the molecular formula C36H50F2N6O8S2 and a molecular weight of 796.96 g/mol. Its IUPAC name is 2,7-diamino-1,8-bis[6-[(4-fluorophenyl)methoxy]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]octane-1,8-dione.
| Compound Name | 2,7-diamino-1,8-bis[6-[(4-fluorophenyl)methoxy]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]octane-1,8-dione |
|---|---|
| PubChem CID | 77379193 |
| Molecular Formula | C36H50F2N6O8S2 |
| Molecular Weight | 796.96 g/mol |
| Exact Mass | 796.31 |
| IUPAC Name | 2,7-diamino-1,8-bis[6-[(4-fluorophenyl)methoxy]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]octane-1,8-dione |
| SMILES | CS(=O)(=O)N1CC(OCc2ccc(F)cc2)C2C1CCN2C(=O)C(N)CCCCC(N)C(=O)N1CCC2C1C(OCc1ccc(F)cc1)CN2S(C)(=O)=O |
| InChI | InChI=1S/C36H50F2N6O8S2/c1-53(47,48)43-19-31(51-21-23-7-11-25(37)12-8-23)33-29(43)15-17-41(33)35(45)27(39)5-3-4-6-28(40)36(46)42-18-16-30-34(42)32(20-44(30)54(2,49)50)52-22-24-9-13-26(38)14-10-24/h7-14,27-34H,3-6,15-22,39-40H2,1-2H3 |
| InChIKey | QCHMWKYTEHAVOF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 185.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.96 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|