C12H23NO — CID 77387393
2-cyclooct-4-en-1-yloxy-N,N-dimethylethanamine (PubChem CID 77387393) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-cyclooct-4-en-1-yloxy-N,N-dimethylethanamine.
| Compound Name | 2-cyclooct-4-en-1-yloxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 77387393 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-cyclooct-4-en-1-yloxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCOC1CCC=CCCC1 |
| InChI | InChI=1S/C12H23NO/c1-13(2)10-11-14-12-8-6-4-3-5-7-9-12/h3-4,12H,5-11H2,1-2H3 |
| InChIKey | XYTMNLNJNZLXFN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|