C21H23FN4O2 — CID 77403967
4-[[2-amino-1-(3-fluoro-4-methoxyphenyl)-2-methylpropyl]amino]quinoline-8-carboxamide (PubChem CID 77403967) has the molecular formula C21H23FN4O2 and a molecular weight of 382.44 g/mol. Its IUPAC name is 4-[[2-amino-1-(3-fluoro-4-methoxyphenyl)-2-methylpropyl]amino]quinoline-8-carboxamide.
| Compound Name | 4-[[2-amino-1-(3-fluoro-4-methoxyphenyl)-2-methylpropyl]amino]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 77403967 |
| Molecular Formula | C21H23FN4O2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 4-[[2-amino-1-(3-fluoro-4-methoxyphenyl)-2-methylpropyl]amino]quinoline-8-carboxamide |
| SMILES | COc1ccc(C(Nc2ccnc3c(C(N)=O)cccc23)C(C)(C)N)cc1F |
| InChI | InChI=1S/C21H23FN4O2/c1-21(2,24)19(12-7-8-17(28-3)15(22)11-12)26-16-9-10-25-18-13(16)5-4-6-14(18)20(23)27/h4-11,19H,24H2,1-3H3,(H2,23,27)(H,25,26) |
| InChIKey | DBVJDDURUMRVSR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |