C24H28N2O — CID 77405515
17-(5-amino-3-pyridinyl)-10,13-dimethyl-1,2,6,7,8,9,11,12-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 77405515) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is 17-(5-amino-3-pyridinyl)-10,13-dimethyl-1,2,6,7,8,9,11,12-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-(5-amino-3-pyridinyl)-10,13-dimethyl-1,2,6,7,8,9,11,12-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 77405515 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 17-(5-amino-3-pyridinyl)-10,13-dimethyl-1,2,6,7,8,9,11,12-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC3C(CCC4=CC(=O)CCC43C)C1=CC=C2c1cncc(N)c1 |
| InChI | InChI=1S/C24H28N2O/c1-23-9-7-18(27)12-16(23)3-4-19-21-6-5-20(15-11-17(25)14-26-13-15)24(21,2)10-8-22(19)23/h5-6,11-14,19,22H,3-4,7-10,25H2,1-2H3 |
| InChIKey | WUUMBUBAKIYLDO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |