C27H35NO2 — CID 77405728
3-(6,10,13-trimethylspiro[1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl)pyridine (PubChem CID 77405728) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is 3-(6,10,13-trimethylspiro[1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl)pyridine.
| Compound Name | 3-(6,10,13-trimethylspiro[1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl)pyridine |
|---|---|
| PubChem CID | 77405728 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 3-(6,10,13-trimethylspiro[1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl)pyridine |
| SMILES | CC1=C2CC3(CCC2(C)C2CCC4(C)C(c5cccnc5)=CCC4C2C1)OCCO3 |
| InChI | InChI=1S/C27H35NO2/c1-18-15-20-22-7-6-21(19-5-4-12-28-17-19)25(22,2)9-8-23(20)26(3)10-11-27(16-24(18)26)29-13-14-30-27/h4-6,12,17,20,22-23H,7-11,13-16H2,1-3H3 |
| InChIKey | PSQIEWKGAZSQBY-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|