C22H26N4O2 — CID 77408250
3-ethyl-4-[[1-(3-methoxyphenyl)-2-(methylamino)ethyl]amino]quinoline-8-carboxamide (PubChem CID 77408250) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 3-ethyl-4-[[1-(3-methoxyphenyl)-2-(methylamino)ethyl]amino]quinoline-8-carboxamide.
| Compound Name | 3-ethyl-4-[[1-(3-methoxyphenyl)-2-(methylamino)ethyl]amino]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 77408250 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 3-ethyl-4-[[1-(3-methoxyphenyl)-2-(methylamino)ethyl]amino]quinoline-8-carboxamide |
| SMILES | CCc1cnc2c(C(N)=O)cccc2c1NC(CNC)c1cccc(OC)c1 |
| InChI | InChI=1S/C22H26N4O2/c1-4-14-12-25-21-17(9-6-10-18(21)22(23)27)20(14)26-19(13-24-2)15-7-5-8-16(11-15)28-3/h5-12,19,24H,4,13H2,1-3H3,(H2,23,27)(H,25,26) |
| InChIKey | QWXDFRZUJPLCCV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |