C22H25N3O3 — CID 159201934
3-(hydroxymethyl)-4-[[(1R)-1-(3-methoxyphenyl)butyl]amino]quinoline-8-carboxamide (PubChem CID 159201934) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-(hydroxymethyl)-4-[[(1R)-1-(3-methoxyphenyl)butyl]amino]quinoline-8-carboxamide.
| Compound Name | 3-(hydroxymethyl)-4-[[(1R)-1-(3-methoxyphenyl)butyl]amino]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 159201934 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-(hydroxymethyl)-4-[[(1R)-1-(3-methoxyphenyl)butyl]amino]quinoline-8-carboxamide |
| SMILES | CCC[C@@H](Nc1c(CO)cnc2c(C(N)=O)cccc12)c1cccc(OC)c1 |
| InChI | InChI=1S/C22H25N3O3/c1-3-6-19(14-7-4-8-16(11-14)28-2)25-20-15(13-26)12-24-21-17(20)9-5-10-18(21)22(23)27/h4-5,7-12,19,26H,3,6,13H2,1-2H3,(H2,23,27)(H,24,25)/t19-/m1/s1 |
| InChIKey | KPKAHCZQILFBCL-LJQANCHMSA-N |
| XLogP | 3.79 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |