C16H13ClO3 — CID 77424580
3-[2-(2-chloro-4-hydroxyphenyl)cyclopropyl]benzoic acid (PubChem CID 77424580) has the molecular formula C16H13ClO3 and a molecular weight of 288.73 g/mol. Its IUPAC name is 3-[2-(2-chloro-4-hydroxyphenyl)cyclopropyl]benzoic acid.
| Compound Name | 3-[2-(2-chloro-4-hydroxyphenyl)cyclopropyl]benzoic acid |
|---|---|
| PubChem CID | 77424580 |
| Molecular Formula | C16H13ClO3 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 3-[2-(2-chloro-4-hydroxyphenyl)cyclopropyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C2CC2c2ccc(O)cc2Cl)c1 |
| InChI | InChI=1S/C16H13ClO3/c17-15-7-11(18)4-5-12(15)14-8-13(14)9-2-1-3-10(6-9)16(19)20/h1-7,13-14,18H,8H2,(H,19,20) |
| InChIKey | CQPCOVHQAPMYLX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |