C16H17NO5 — CID 77443724
1-[2-hydroxy-6-methoxy-4-(methoxymethoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one (PubChem CID 77443724) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 1-[2-hydroxy-6-methoxy-4-(methoxymethoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one.
| Compound Name | 1-[2-hydroxy-6-methoxy-4-(methoxymethoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 77443724 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-[2-hydroxy-6-methoxy-4-(methoxymethoxy)phenyl]-3-(1H-pyrrol-2-yl)prop-2-en-1-one |
| SMILES | COCOc1cc(O)c(C(=O)C=Cc2ccc[nH]2)c(OC)c1 |
| InChI | InChI=1S/C16H17NO5/c1-20-10-22-12-8-14(19)16(15(9-12)21-2)13(18)6-5-11-4-3-7-17-11/h3-9,17,19H,10H2,1-2H3 |
| InChIKey | NBRBHARPCWKWCB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|