C21H28F2N2O2 — CID 77456424
4-[3-(3,5-difluorophenyl)prop-2-enoyl]-3,6-bis(2-methylpropyl)piperazin-2-one (PubChem CID 77456424) has the molecular formula C21H28F2N2O2 and a molecular weight of 378.46 g/mol. Its IUPAC name is 4-[3-(3,5-difluorophenyl)prop-2-enoyl]-3,6-bis(2-methylpropyl)piperazin-2-one.
| Compound Name | 4-[3-(3,5-difluorophenyl)prop-2-enoyl]-3,6-bis(2-methylpropyl)piperazin-2-one |
|---|---|
| PubChem CID | 77456424 |
| Molecular Formula | C21H28F2N2O2 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 4-[3-(3,5-difluorophenyl)prop-2-enoyl]-3,6-bis(2-methylpropyl)piperazin-2-one |
| SMILES | CC(C)CC1CN(C(=O)C=Cc2cc(F)cc(F)c2)C(CC(C)C)C(=O)N1 |
| InChI | InChI=1S/C21H28F2N2O2/c1-13(2)7-18-12-25(19(8-14(3)4)21(27)24-18)20(26)6-5-15-9-16(22)11-17(23)10-15/h5-6,9-11,13-14,18-19H,7-8,12H2,1-4H3,(H,24,27) |
| InChIKey | XRSXHTULUIOSDQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|