C21H27F3N2O2 — CID 77456553
3,6-bis(2-methylpropyl)-4-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperazin-2-one (PubChem CID 77456553) has the molecular formula C21H27F3N2O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3,6-bis(2-methylpropyl)-4-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperazin-2-one.
| Compound Name | 3,6-bis(2-methylpropyl)-4-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperazin-2-one |
|---|---|
| PubChem CID | 77456553 |
| Molecular Formula | C21H27F3N2O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3,6-bis(2-methylpropyl)-4-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperazin-2-one |
| SMILES | CC(C)CC1CN(C(=O)C=Cc2cc(F)c(F)c(F)c2)C(CC(C)C)C(=O)N1 |
| InChI | InChI=1S/C21H27F3N2O2/c1-12(2)7-15-11-26(18(8-13(3)4)21(28)25-15)19(27)6-5-14-9-16(22)20(24)17(23)10-14/h5-6,9-10,12-13,15,18H,7-8,11H2,1-4H3,(H,25,28) |
| InChIKey | LTFZXBOZJGKBOR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|