C28H36FO6PS — CID 77458323
diethyl 4-[2-[6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]-1-hydroxyethoxy]butyl phosphate (PubChem CID 77458323) has the molecular formula C28H36FO6PS and a molecular weight of 550.63 g/mol. Its IUPAC name is diethyl 4-[2-[6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]-1-hydroxyethoxy]butyl phosphate.
| Compound Name | diethyl 4-[2-[6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]-1-hydroxyethoxy]butyl phosphate |
|---|---|
| PubChem CID | 77458323 |
| Molecular Formula | C28H36FO6PS |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | diethyl 4-[2-[6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]-1-hydroxyethoxy]butyl phosphate |
| SMILES | CCOP(=O)(OCC)OCCCCOC(O)CC1=C(C)C(=Cc2ccc(SC)cc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C28H36FO6PS/c1-5-33-36(31,34-6-2)35-16-8-7-15-32-28(30)19-26-20(3)25(24-14-11-22(29)18-27(24)26)17-21-9-12-23(37-4)13-10-21/h9-14,17-18,28,30H,5-8,15-16,19H2,1-4H3 |
| InChIKey | JLUCGTGMHFFFDJ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|