C43H55F3N2O2 — CID 77467693
4-[5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-3a-[[3-(trifluoromethyl)-2-pyridinyl]methylamino]-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 77467693) has the molecular formula C43H55F3N2O2 and a molecular weight of 688.92 g/mol. Its IUPAC name is 4-[5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-3a-[[3-(trifluoromethyl)-2-pyridinyl]methylamino]-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-3a-[[3-(trifluoromethyl)-2-pyridinyl]methylamino]-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 77467693 |
| Molecular Formula | C43H55F3N2O2 |
| Molecular Weight | 688.92 g/mol |
| Exact Mass | 688.42 |
| IUPAC Name | 4-[5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-3a-[[3-(trifluoromethyl)-2-pyridinyl]methylamino]-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)C1CCC2(NCc3ncccc3C(F)(F)F)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C43H55F3N2O2/c1-26(2)29-16-21-42(48-25-33-31(43(44,45)46)9-8-24-47-33)23-22-40(6)32(36(29)42)14-15-35-39(5)19-17-30(27-10-12-28(13-11-27)37(49)50)38(3,4)34(39)18-20-41(35,40)7/h8-13,17,24,29,32,34-36,48H,1,14-16,18-23,25H2,2-7H3,(H,49,50) |
| InChIKey | JSZFSJZQVJFBSW-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.92 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|