C12H14N4O4 — CID 7756933
N-[(1R)-1-cyano-1-cyclopropylethyl]-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide (PubChem CID 7756933) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is N-[(1R)-1-cyano-1-cyclopropylethyl]-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[(1R)-1-cyano-1-cyclopropylethyl]-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 7756933 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | N-[(1R)-1-cyano-1-cyclopropylethyl]-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
| SMILES | CN1C(=O)C(=O)N(CC(=O)N[C@@](C)(C#N)C2CC2)C1=O |
| InChI | InChI=1S/C12H14N4O4/c1-12(6-13,7-3-4-7)14-8(17)5-16-10(19)9(18)15(2)11(16)20/h7H,3-5H2,1-2H3,(H,14,17)/t12-/m0/s1 |
| InChIKey | ADHXUMZZEGZJOK-LBPRGKRZSA-N |
| XLogP | -0.78 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|