C11H16N4O5 — CID 7756730
N-(tert-butylcarbamoyl)-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide (PubChem CID 7756730) has the molecular formula C11H16N4O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is N-(tert-butylcarbamoyl)-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(tert-butylcarbamoyl)-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 7756730 |
| Molecular Formula | C11H16N4O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-(tert-butylcarbamoyl)-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
| SMILES | CN1C(=O)C(=O)N(CC(=O)NC(=O)NC(C)(C)C)C1=O |
| InChI | InChI=1S/C11H16N4O5/c1-11(2,3)13-9(19)12-6(16)5-15-8(18)7(17)14(4)10(15)20/h5H2,1-4H3,(H2,12,13,16,19) |
| InChIKey | JHIQTMRWODMJGO-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|