C12H18N4O5 — CID 7824261
N-[[(2S)-butan-2-yl]carbamoyl]-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetamide (PubChem CID 7824261) has the molecular formula C12H18N4O5 and a molecular weight of 298.30 g/mol. Its IUPAC name is N-[[(2S)-butan-2-yl]carbamoyl]-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[[(2S)-butan-2-yl]carbamoyl]-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 7824261 |
| Molecular Formula | C12H18N4O5 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[[(2S)-butan-2-yl]carbamoyl]-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
| SMILES | CC[C@H](C)NC(=O)NC(=O)CN1C(=O)C(=O)N(CC)C1=O |
| InChI | InChI=1S/C12H18N4O5/c1-4-7(3)13-11(20)14-8(17)6-16-10(19)9(18)15(5-2)12(16)21/h7H,4-6H2,1-3H3,(H2,13,14,17,20)/t7-/m0/s1 |
| InChIKey | LEZJVRIFOMFZKM-ZETCQYMHSA-N |
| XLogP | -0.58 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|