C12H18N4O5 — CID 9374548
(2R)-N-ethyl-2-[[2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]propanamide (PubChem CID 9374548) has the molecular formula C12H18N4O5 and a molecular weight of 298.30 g/mol. Its IUPAC name is (2R)-N-ethyl-2-[[2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]propanamide.
| Compound Name | (2R)-N-ethyl-2-[[2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 9374548 |
| Molecular Formula | C12H18N4O5 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2R)-N-ethyl-2-[[2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]propanamide |
| SMILES | CCNC(=O)[C@@H](C)NC(=O)CN1C(=O)C(=O)N(CC)C1=O |
| InChI | InChI=1S/C12H18N4O5/c1-4-13-9(18)7(3)14-8(17)6-16-11(20)10(19)15(5-2)12(16)21/h7H,4-6H2,1-3H3,(H,13,18)(H,14,17)/t7-/m1/s1 |
| InChIKey | ZRLJSWZWQHCMDT-SSDOTTSWSA-N |
| XLogP | -1.56 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|