About 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide
2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide (PubChem CID 9374526) has the molecular formula C11H16N4O5
and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide.
Molecular Properties
| Compound Name | 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide |
| PubChem CID | 9374526 |
| Molecular Formula | C11H16N4O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide |
| SMILES | CCN1C(=O)C(=O)N(CC(=O)N(C)CC(=O)NC)C1=O |
| InChI | InChI=1S/C11H16N4O5/c1-4-14-9(18)10(19)15(11(14)20)6-8(17)13(3)5-7(16)12-2/h4-6H2,1-3H3,(H,12,16) |
| InChIKey | RNXURSLBZUMWSY-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide?
The IUPAC name of 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide (CID 9374526) is 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide.
What is the SMILES notation for 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide?
The canonical SMILES for 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide is CCN1C(=O)C(=O)N(CC(=O)N(C)CC(=O)NC)C1=O.
What is the InChIKey of 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide?
The InChIKey is RNXURSLBZUMWSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O5/c1-4-14-9(18)10(19)15(11(14)20)6-8(17)13(3)5-7(16)12-2/h4-6H2,1-3H3,(H,12,16).
What are the key properties of 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide?
2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide has a molecular weight of 284.27 g/mol, XLogP of -2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methyl-N-[2-(methylamino)-2-oxoethyl]acetamide is sourced from PubChem (CID 9374526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).