C18H23N3O6 — CID 9341899
N-[(4,5-dimethoxy-2-methylphenyl)methyl]-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methylacetamide (PubChem CID 9341899) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-2-methylphenyl)methyl]-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methylacetamide.
| Compound Name | N-[(4,5-dimethoxy-2-methylphenyl)methyl]-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 9341899 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[(4,5-dimethoxy-2-methylphenyl)methyl]-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-methylacetamide |
| SMILES | CCN1C(=O)C(=O)N(CC(=O)N(C)Cc2cc(OC)c(OC)cc2C)C1=O |
| InChI | InChI=1S/C18H23N3O6/c1-6-20-16(23)17(24)21(18(20)25)10-15(22)19(3)9-12-8-14(27-5)13(26-4)7-11(12)2/h7-8H,6,9-10H2,1-5H3 |
| InChIKey | UIASGNIMBLCOKF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|