C17H19N3O5 — CID 7824265
2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(2R)-3-oxo-1-phenylbutan-2-yl]acetamide (PubChem CID 7824265) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(2R)-3-oxo-1-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(2R)-3-oxo-1-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 7824265 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(2R)-3-oxo-1-phenylbutan-2-yl]acetamide |
| SMILES | CCN1C(=O)C(=O)N(CC(=O)N[C@H](Cc2ccccc2)C(C)=O)C1=O |
| InChI | InChI=1S/C17H19N3O5/c1-3-19-15(23)16(24)20(17(19)25)10-14(22)18-13(11(2)21)9-12-7-5-4-6-8-12/h4-8,13H,3,9-10H2,1-2H3,(H,18,22)/t13-/m1/s1 |
| InChIKey | LIPIAZBIFJARHZ-CYBMUJFWSA-N |
| XLogP | 0.11 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|