C20H23N3O5 — CID 7756589
2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide (PubChem CID 7756589) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 7756589 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-(3-cyclopentyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide |
| SMILES | CC(=O)[C@H](Cc1ccccc1)NC(=O)CN1C(=O)C(=O)N(C2CCCC2)C1=O |
| InChI | InChI=1S/C20H23N3O5/c1-13(24)16(11-14-7-3-2-4-8-14)21-17(25)12-22-18(26)19(27)23(20(22)28)15-9-5-6-10-15/h2-4,7-8,15-16H,5-6,9-12H2,1H3,(H,21,25)/t16-/m0/s1 |
| InChIKey | CJEJKKGQMGBYJM-INIZCTEOSA-N |
| XLogP | 1.04 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|