C18H22N6O2S — CID 7757118
N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide (PubChem CID 7757118) has the molecular formula C18H22N6O2S and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7757118 |
| Molecular Formula | C18H22N6O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccccc1)NC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H22N6O2S/c25-16(20-17(26)19-12-11-14-7-3-1-4-8-14)13-27-18-21-22-23-24(18)15-9-5-2-6-10-15/h2,5-7,9-10H,1,3-4,8,11-13H2,(H2,19,20,25,26) |
| InChIKey | KCHSZSUBPAYWGA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|