C15H32NO+ — CID 7758908
2-[(2S,6S)-2,6-bis(2-methylpropyl)piperidin-1-ium-1-yl]ethanol (PubChem CID 7758908) has the molecular formula C15H32NO+ and a molecular weight of 242.43 g/mol. Its IUPAC name is 2-[(2S,6S)-2,6-bis(2-methylpropyl)piperidin-1-ium-1-yl]ethanol.
| Compound Name | 2-[(2S,6S)-2,6-bis(2-methylpropyl)piperidin-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 7758908 |
| Molecular Formula | C15H32NO+ |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.25 |
| IUPAC Name | 2-[(2S,6S)-2,6-bis(2-methylpropyl)piperidin-1-ium-1-yl]ethanol |
| SMILES | CC(C)C[C@@H]1CCC[C@@H](CC(C)C)[NH+]1CCO |
| InChI | InChI=1S/C15H31NO/c1-12(2)10-14-6-5-7-15(11-13(3)4)16(14)8-9-17/h12-15,17H,5-11H2,1-4H3/p+1/t14-,15-/m0/s1 |
| InChIKey | VCBVSHSBEVILBE-GJZGRUSLSA-O |
| XLogP | 1.88 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |