C14H14N2O4S — CID 7774376
[2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 1-oxidopyridin-1-ium-2-carboxylate (PubChem CID 7774376) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 1-oxidopyridin-1-ium-2-carboxylate.
| Compound Name | [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 1-oxidopyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 7774376 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 1-oxidopyridin-1-ium-2-carboxylate |
| SMILES | C[C@H](NC(=O)COC(=O)c1cccc[n+]1[O-])c1cccs1 |
| InChI | InChI=1S/C14H14N2O4S/c1-10(12-6-4-8-21-12)15-13(17)9-20-14(18)11-5-2-3-7-16(11)19/h2-8,10H,9H2,1H3,(H,15,17)/t10-/m0/s1 |
| InChIKey | CWTDSQCDUSTFTK-JTQLQIEISA-N |
| XLogP | 1.42 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|