C13H14NO4- — CID 7784434
2-[[(2E)-2-[(3-hydroxyphenyl)methylidene]butanoyl]amino]acetate (PubChem CID 7784434) has the molecular formula C13H14NO4- and a molecular weight of 248.26 g/mol. Its IUPAC name is 2-[[(2E)-2-[(3-hydroxyphenyl)methylidene]butanoyl]amino]acetate.
| Compound Name | 2-[[(2E)-2-[(3-hydroxyphenyl)methylidene]butanoyl]amino]acetate |
|---|---|
| PubChem CID | 7784434 |
| Molecular Formula | C13H14NO4- |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-[[(2E)-2-[(3-hydroxyphenyl)methylidene]butanoyl]amino]acetate |
| SMILES | CC/C(=C\c1cccc(O)c1)C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C13H15NO4/c1-2-10(13(18)14-8-12(16)17)6-9-4-3-5-11(15)7-9/h3-7,15H,2,8H2,1H3,(H,14,18)(H,16,17)/p-1/b10-6+ |
| InChIKey | DUOJSDXPYDWCRW-UXBLZVDNSA-M |
| XLogP | 0.05 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|