C19H22N4O5 — CID 7784589
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate (PubChem CID 7784589) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 7784589 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 3-nitro-4-pyrrolidin-1-ylbenzoate |
| SMILES | N#CC1(NC(=O)COC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)CCCC1 |
| InChI | InChI=1S/C19H22N4O5/c20-13-19(7-1-2-8-19)21-17(24)12-28-18(25)14-5-6-15(16(11-14)23(26)27)22-9-3-4-10-22/h5-6,11H,1-4,7-10,12H2,(H,21,24) |
| InChIKey | WXQUTNSCCSOYFJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|