C18H14N2O2S2 — CID 7803319
[(1R)-1-cyanoethyl] 2-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoate (PubChem CID 7803319) has the molecular formula C18H14N2O2S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 2-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoate.
| Compound Name | [(1R)-1-cyanoethyl] 2-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoate |
|---|---|
| PubChem CID | 7803319 |
| Molecular Formula | C18H14N2O2S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | [(1R)-1-cyanoethyl] 2-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoate |
| SMILES | C[C@H](C#N)OC(=O)c1ccccc1CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H14N2O2S2/c1-12(10-19)22-17(21)14-7-3-2-6-13(14)11-23-18-20-15-8-4-5-9-16(15)24-18/h2-9,12H,11H2,1H3/t12-/m1/s1 |
| InChIKey | JYMGVGAGCAFLOY-GFCCVEGCSA-N |
| XLogP | 4.66 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |