C21H20N2O3S2 — CID 8980676
[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoate (PubChem CID 8980676) has the molecular formula C21H20N2O3S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoate.
| Compound Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoate |
|---|---|
| PubChem CID | 8980676 |
| Molecular Formula | C21H20N2O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-(1,3-benzothiazol-2-ylsulfanylmethyl)benzoate |
| SMILES | C=CCNC(=O)[C@@H](C)OC(=O)c1ccccc1CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C21H20N2O3S2/c1-3-12-22-19(24)14(2)26-20(25)16-9-5-4-8-15(16)13-27-21-23-17-10-6-7-11-18(17)28-21/h3-11,14H,1,12-13H2,2H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | MRJLSTVNPGDASS-CQSZACIVSA-N |
| XLogP | 4.44 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|